C17H29N5O — CID 18998546
4-(2-aminopropan-2-yl)-N-[2-(2,2-dimethylhydrazinyl)-4-pyridinyl]cyclohexane-1-carboxamide (PubChem CID 18998546) has the molecular formula C17H29N5O and a molecular weight of 319.45 g/mol. Its IUPAC name is 4-(2-aminopropan-2-yl)-N-[2-(2,2-dimethylhydrazinyl)-4-pyridinyl]cyclohexane-1-carboxamide.
| Compound Name | 4-(2-aminopropan-2-yl)-N-[2-(2,2-dimethylhydrazinyl)-4-pyridinyl]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 18998546 |
| Molecular Formula | C17H29N5O |
| Molecular Weight | 319.45 g/mol |
| Exact Mass | 319.24 |
| IUPAC Name | 4-(2-aminopropan-2-yl)-N-[2-(2,2-dimethylhydrazinyl)-4-pyridinyl]cyclohexane-1-carboxamide |
| SMILES | CN(C)Nc1cc(NC(=O)C2CCC(C(C)(C)N)CC2)ccn1 |
| InChI | InChI=1S/C17H29N5O/c1-17(2,18)13-7-5-12(6-8-13)16(23)20-14-9-10-19-15(11-14)21-22(3)4/h9-13H,5-8,18H2,1-4H3,(H2,19,20,21,23) |
| InChIKey | RWTSNFPLOXMSRD-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 83.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.45 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|