C13H8N4S — CID 18999807
7-thiophen-2-yl-1H-pyrazolo[4,3-g]quinoxaline (PubChem CID 18999807) has the molecular formula C13H8N4S and a molecular weight of 252.30 g/mol. Its IUPAC name is 7-thiophen-2-yl-1H-pyrazolo[4,3-g]quinoxaline.
| Compound Name | 7-thiophen-2-yl-1H-pyrazolo[4,3-g]quinoxaline |
|---|---|
| PubChem CID | 18999807 |
| Molecular Formula | C13H8N4S |
| Molecular Weight | 252.30 g/mol |
| Exact Mass | 252.05 |
| IUPAC Name | 7-thiophen-2-yl-1H-pyrazolo[4,3-g]quinoxaline |
| SMILES | c1csc(-c2cnc3cc4cn[nH]c4cc3n2)c1 |
| InChI | InChI=1S/C13H8N4S/c1-2-13(18-3-1)12-7-14-10-4-8-6-15-17-9(8)5-11(10)16-12/h1-7H,(H,15,17) |
| InChIKey | HKRNHNOTPLYQBV-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.30 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |