C16H14N4OS — CID 18999865
1-(2-methoxyethyl)-7-thiophen-3-ylpyrazolo[4,3-g]quinoxaline (PubChem CID 18999865) has the molecular formula C16H14N4OS and a molecular weight of 310.38 g/mol. Its IUPAC name is 1-(2-methoxyethyl)-7-thiophen-3-ylpyrazolo[4,3-g]quinoxaline.
| Compound Name | 1-(2-methoxyethyl)-7-thiophen-3-ylpyrazolo[4,3-g]quinoxaline |
|---|---|
| PubChem CID | 18999865 |
| Molecular Formula | C16H14N4OS |
| Molecular Weight | 310.38 g/mol |
| Exact Mass | 310.09 |
| IUPAC Name | 1-(2-methoxyethyl)-7-thiophen-3-ylpyrazolo[4,3-g]quinoxaline |
| SMILES | COCCn1ncc2cc3ncc(-c4ccsc4)nc3cc21 |
| InChI | InChI=1S/C16H14N4OS/c1-21-4-3-20-16-7-14-13(6-12(16)8-18-20)17-9-15(19-14)11-2-5-22-10-11/h2,5-10H,3-4H2,1H3 |
| InChIKey | OGXRGCOHBQZQLR-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 52.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.38 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |