About 2-[(2,3-difluorophenoxy)methyl]-1-methylpyrrolidine;hydrochloride
2-[(2,3-difluorophenoxy)methyl]-1-methylpyrrolidine;hydrochloride (PubChem CID 19002688) has the molecular formula C12H16ClF2NO
and a molecular weight of 263.71 g/mol. Its IUPAC name is 2-[(2,3-difluorophenoxy)methyl]-1-methylpyrrolidine;hydrochloride.
Molecular Properties
| Compound Name | 2-[(2,3-difluorophenoxy)methyl]-1-methylpyrrolidine;hydrochloride |
| PubChem CID | 19002688 |
| Molecular Formula | C12H16ClF2NO |
| Molecular Weight | 263.71 g/mol |
| Exact Mass | 263.09 |
| IUPAC Name | 2-[(2,3-difluorophenoxy)methyl]-1-methylpyrrolidine;hydrochloride |
| SMILES | CN1CCCC1COc1cccc(F)c1F.Cl |
| InChI | InChI=1S/C12H15F2NO.ClH/c1-15-7-3-4-9(15)8-16-11-6-2-5-10(13)12(11)14;/h2,5-6,9H,3-4,7-8H2,1H3;1H |
| InChIKey | SDRTWAABSMEIGH-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.71 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[(2,3-difluorophenoxy)methyl]-1-methylpyrrolidine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2,3-difluorophenoxy)methyl]-1-methylpyrrolidine;hydrochloride?
The IUPAC name of 2-[(2,3-difluorophenoxy)methyl]-1-methylpyrrolidine;hydrochloride (CID 19002688) is 2-[(2,3-difluorophenoxy)methyl]-1-methylpyrrolidine;hydrochloride.
What is the SMILES notation for 2-[(2,3-difluorophenoxy)methyl]-1-methylpyrrolidine;hydrochloride?
The canonical SMILES for 2-[(2,3-difluorophenoxy)methyl]-1-methylpyrrolidine;hydrochloride is CN1CCCC1COc1cccc(F)c1F.Cl.
What is the InChIKey of 2-[(2,3-difluorophenoxy)methyl]-1-methylpyrrolidine;hydrochloride?
The InChIKey is SDRTWAABSMEIGH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15F2NO.ClH/c1-15-7-3-4-9(15)8-16-11-6-2-5-10(13)12(11)14;/h2,5-6,9H,3-4,7-8H2,1H3;1H.
What are the key properties of 2-[(2,3-difluorophenoxy)methyl]-1-methylpyrrolidine;hydrochloride?
2-[(2,3-difluorophenoxy)methyl]-1-methylpyrrolidine;hydrochloride has a molecular weight of 263.71 g/mol, XLogP of 2.86, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2,3-difluorophenoxy)methyl]-1-methylpyrrolidine;hydrochloride is sourced from PubChem (CID 19002688), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).