C16H20O2S — CID 19002823
1-(6-methoxy-1-benzothiophen-2-yl)cycloheptan-1-ol (PubChem CID 19002823) has the molecular formula C16H20O2S and a molecular weight of 276.40 g/mol. Its IUPAC name is 1-(6-methoxy-1-benzothiophen-2-yl)cycloheptan-1-ol.
| Compound Name | 1-(6-methoxy-1-benzothiophen-2-yl)cycloheptan-1-ol |
|---|---|
| PubChem CID | 19002823 |
| Molecular Formula | C16H20O2S |
| Molecular Weight | 276.40 g/mol |
| Exact Mass | 276.12 |
| IUPAC Name | 1-(6-methoxy-1-benzothiophen-2-yl)cycloheptan-1-ol |
| SMILES | COc1ccc2cc(C3(O)CCCCCC3)sc2c1 |
| InChI | InChI=1S/C16H20O2S/c1-18-13-7-6-12-10-15(19-14(12)11-13)16(17)8-4-2-3-5-9-16/h6-7,10-11,17H,2-5,8-9H2,1H3 |
| InChIKey | YRYUPKUFJFAIDF-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.40 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |