C18H28N2Si2 — CID 19003478
N-trimethylsilyl-4-[4-(trimethylsilylamino)phenyl]aniline (PubChem CID 19003478) has the molecular formula C18H28N2Si2 and a molecular weight of 328.61 g/mol. Its IUPAC name is N-trimethylsilyl-4-[4-(trimethylsilylamino)phenyl]aniline.
| Compound Name | N-trimethylsilyl-4-[4-(trimethylsilylamino)phenyl]aniline |
|---|---|
| PubChem CID | 19003478 |
| Molecular Formula | C18H28N2Si2 |
| Molecular Weight | 328.61 g/mol |
| Exact Mass | 328.18 |
| IUPAC Name | N-trimethylsilyl-4-[4-(trimethylsilylamino)phenyl]aniline |
| SMILES | C[Si](C)(C)Nc1ccc(-c2ccc(N[Si](C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C18H28N2Si2/c1-21(2,3)19-17-11-7-15(8-12-17)16-9-13-18(14-10-16)20-22(4,5)6/h7-14,19-20H,1-6H3 |
| InChIKey | YWHSGYFHFLICKU-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.61 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|