C23H39ClN2O3 — CID 19004706
5-[4-[2-(dimethylamino)ethoxy]-3-methoxyphenyl]-N-(4-methylcyclohexyl)pentanamide;hydrochloride (PubChem CID 19004706) has the molecular formula C23H39ClN2O3 and a molecular weight of 427.03 g/mol. Its IUPAC name is 5-[4-[2-(dimethylamino)ethoxy]-3-methoxyphenyl]-N-(4-methylcyclohexyl)pentanamide;hydrochloride.
| Compound Name | 5-[4-[2-(dimethylamino)ethoxy]-3-methoxyphenyl]-N-(4-methylcyclohexyl)pentanamide;hydrochloride |
|---|---|
| PubChem CID | 19004706 |
| Molecular Formula | C23H39ClN2O3 |
| Molecular Weight | 427.03 g/mol |
| Exact Mass | 426.26 |
| IUPAC Name | 5-[4-[2-(dimethylamino)ethoxy]-3-methoxyphenyl]-N-(4-methylcyclohexyl)pentanamide;hydrochloride |
| SMILES | COc1cc(CCCCC(=O)NC2CCC(C)CC2)ccc1OCCN(C)C.Cl |
| InChI | InChI=1S/C23H38N2O3.ClH/c1-18-9-12-20(13-10-18)24-23(26)8-6-5-7-19-11-14-21(22(17-19)27-4)28-16-15-25(2)3;/h11,14,17-18,20H,5-10,12-13,15-16H2,1-4H3,(H,24,26);1H |
| InChIKey | LUHKLUYRYXFKET-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.03 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|