C8H7NO2 — CID 19006844
7-methoxy-1,2-benzoxazole (PubChem CID 19006844) has the molecular formula C8H7NO2 and a molecular weight of 149.15 g/mol. Its IUPAC name is 7-methoxy-1,2-benzoxazole.
| Compound Name | 7-methoxy-1,2-benzoxazole |
|---|---|
| PubChem CID | 19006844 |
| Molecular Formula | C8H7NO2 |
| Molecular Weight | 149.15 g/mol |
| Exact Mass | 149.05 |
| IUPAC Name | 7-methoxy-1,2-benzoxazole |
| SMILES | COc1cccc2cnoc12 |
| InChI | InChI=1S/C8H7NO2/c1-10-7-4-2-3-6-5-9-11-8(6)7/h2-5H,1H3 |
| InChIKey | AUZSBHTXASPACC-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 35.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.15 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |