C26H30Cl2N2 — CID 19008089
2,5-bis(3-chloro-4-pentylphenyl)pyrimidine (PubChem CID 19008089) has the molecular formula C26H30Cl2N2 and a molecular weight of 441.45 g/mol. Its IUPAC name is 2,5-bis(3-chloro-4-pentylphenyl)pyrimidine.
| Compound Name | 2,5-bis(3-chloro-4-pentylphenyl)pyrimidine |
|---|---|
| PubChem CID | 19008089 |
| Molecular Formula | C26H30Cl2N2 |
| Molecular Weight | 441.45 g/mol |
| Exact Mass | 440.18 |
| IUPAC Name | 2,5-bis(3-chloro-4-pentylphenyl)pyrimidine |
| SMILES | CCCCCc1ccc(-c2cnc(-c3ccc(CCCCC)c(Cl)c3)nc2)cc1Cl |
| InChI | InChI=1S/C26H30Cl2N2/c1-3-5-7-9-19-11-13-21(15-24(19)27)23-17-29-26(30-18-23)22-14-12-20(25(28)16-22)10-8-6-4-2/h11-18H,3-10H2,1-2H3 |
| InChIKey | NOOPOCKJHQFODB-UHFFFAOYSA-N |
| XLogP | 8.58 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.45 |
| LogP ≤ 5 | 8.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|