C24H33N5O3 — CID 19011886
2-[3-[4-[2,6-dioxo-1,3-di(propan-2-yl)pyrimidin-4-yl]piperazin-1-yl]propoxy]benzonitrile (PubChem CID 19011886) has the molecular formula C24H33N5O3 and a molecular weight of 439.56 g/mol. Its IUPAC name is 2-[3-[4-[2,6-dioxo-1,3-di(propan-2-yl)pyrimidin-4-yl]piperazin-1-yl]propoxy]benzonitrile.
| Compound Name | 2-[3-[4-[2,6-dioxo-1,3-di(propan-2-yl)pyrimidin-4-yl]piperazin-1-yl]propoxy]benzonitrile |
|---|---|
| PubChem CID | 19011886 |
| Molecular Formula | C24H33N5O3 |
| Molecular Weight | 439.56 g/mol |
| Exact Mass | 439.26 |
| IUPAC Name | 2-[3-[4-[2,6-dioxo-1,3-di(propan-2-yl)pyrimidin-4-yl]piperazin-1-yl]propoxy]benzonitrile |
| SMILES | CC(C)n1c(N2CCN(CCCOc3ccccc3C#N)CC2)cc(=O)n(C(C)C)c1=O |
| InChI | InChI=1S/C24H33N5O3/c1-18(2)28-22(16-23(30)29(19(3)4)24(28)31)27-13-11-26(12-14-27)10-7-15-32-21-9-6-5-8-20(21)17-25/h5-6,8-9,16,18-19H,7,10-15H2,1-4H3 |
| InChIKey | ZDLPYPLEJCKTER-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 83.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.56 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|