C28H38O6 — CID 19013093
2,2,3,3-tetramethyl-4,4-bis(4-propan-2-yloxyphenyl)hexanedioic acid (PubChem CID 19013093) has the molecular formula C28H38O6 and a molecular weight of 470.61 g/mol. Its IUPAC name is 2,2,3,3-tetramethyl-4,4-bis(4-propan-2-yloxyphenyl)hexanedioic acid.
| Compound Name | 2,2,3,3-tetramethyl-4,4-bis(4-propan-2-yloxyphenyl)hexanedioic acid |
|---|---|
| PubChem CID | 19013093 |
| Molecular Formula | C28H38O6 |
| Molecular Weight | 470.61 g/mol |
| Exact Mass | 470.27 |
| IUPAC Name | 2,2,3,3-tetramethyl-4,4-bis(4-propan-2-yloxyphenyl)hexanedioic acid |
| SMILES | CC(C)Oc1ccc(C(CC(=O)O)(c2ccc(OC(C)C)cc2)C(C)(C)C(C)(C)C(=O)O)cc1 |
| InChI | InChI=1S/C28H38O6/c1-18(2)33-22-13-9-20(10-14-22)28(17-24(29)30,27(7,8)26(5,6)25(31)32)21-11-15-23(16-12-21)34-19(3)4/h9-16,18-19H,17H2,1-8H3,(H,29,30)(H,31,32) |
| InChIKey | AEDVLKSZEMBDII-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.61 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |