About 3-hydroxy-2,2-dimethyl-3-(4-propan-2-yloxyphenyl)butanoic acid
3-hydroxy-2,2-dimethyl-3-(4-propan-2-yloxyphenyl)butanoic acid (PubChem CID 55071473) has the molecular formula C15H22O4
and a molecular weight of 266.34 g/mol. Its IUPAC name is 3-hydroxy-2,2-dimethyl-3-(4-propan-2-yloxyphenyl)butanoic acid.
Analyze 3-hydroxy-2,2-dimethyl-3-(4-propan-2-yloxyphenyl)butanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-hydroxy-2,2-dimethyl-3-(4-propan-2-yloxyphenyl)butanoic acid?
The IUPAC name of 3-hydroxy-2,2-dimethyl-3-(4-propan-2-yloxyphenyl)butanoic acid (CID 55071473) is 3-hydroxy-2,2-dimethyl-3-(4-propan-2-yloxyphenyl)butanoic acid.
What is the SMILES notation for 3-hydroxy-2,2-dimethyl-3-(4-propan-2-yloxyphenyl)butanoic acid?
The canonical SMILES for 3-hydroxy-2,2-dimethyl-3-(4-propan-2-yloxyphenyl)butanoic acid is CC(C)Oc1ccc(C(C)(O)C(C)(C)C(=O)O)cc1.
What is the InChIKey of 3-hydroxy-2,2-dimethyl-3-(4-propan-2-yloxyphenyl)butanoic acid?
The InChIKey is GZJVRJIIBTYQCE-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22O4/c1-10(2)19-12-8-6-11(7-9-12)15(5,18)14(3,4)13(16)17/h6-10,18H,1-5H3,(H,16,17).
What are the key properties of 3-hydroxy-2,2-dimethyl-3-(4-propan-2-yloxyphenyl)butanoic acid?
3-hydroxy-2,2-dimethyl-3-(4-propan-2-yloxyphenyl)butanoic acid has a molecular weight of 266.34 g/mol, XLogP of 2.79, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hydroxy-2,2-dimethyl-3-(4-propan-2-yloxyphenyl)butanoic acid is sourced from PubChem (CID 55071473), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).