C18H15N3O2 — CID 19013396
2-[1-(2H-isoindol-1-ylmethyl)indazol-3-yl]acetic acid (PubChem CID 19013396) has the molecular formula C18H15N3O2 and a molecular weight of 305.34 g/mol. Its IUPAC name is 2-[1-(2H-isoindol-1-ylmethyl)indazol-3-yl]acetic acid.
| Compound Name | 2-[1-(2H-isoindol-1-ylmethyl)indazol-3-yl]acetic acid |
|---|---|
| PubChem CID | 19013396 |
| Molecular Formula | C18H15N3O2 |
| Molecular Weight | 305.34 g/mol |
| Exact Mass | 305.12 |
| IUPAC Name | 2-[1-(2H-isoindol-1-ylmethyl)indazol-3-yl]acetic acid |
| SMILES | O=C(O)Cc1nn(Cc2[nH]cc3ccccc23)c2ccccc12 |
| InChI | InChI=1S/C18H15N3O2/c22-18(23)9-15-14-7-3-4-8-17(14)21(20-15)11-16-13-6-2-1-5-12(13)10-19-16/h1-8,10,19H,9,11H2,(H,22,23) |
| InChIKey | VLAXSNYHUGEPLJ-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 70.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.34 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |