C17H12ClN3O2S — CID 14458622
2-[1-(1,2-benzothiazol-3-ylmethyl)-5-chloroindazol-3-yl]acetic acid (PubChem CID 14458622) has the molecular formula C17H12ClN3O2S and a molecular weight of 357.82 g/mol. Its IUPAC name is 2-[1-(1,2-benzothiazol-3-ylmethyl)-5-chloroindazol-3-yl]acetic acid.
| Compound Name | 2-[1-(1,2-benzothiazol-3-ylmethyl)-5-chloroindazol-3-yl]acetic acid |
|---|---|
| PubChem CID | 14458622 |
| Molecular Formula | C17H12ClN3O2S |
| Molecular Weight | 357.82 g/mol |
| Exact Mass | 357.03 |
| IUPAC Name | 2-[1-(1,2-benzothiazol-3-ylmethyl)-5-chloroindazol-3-yl]acetic acid |
| SMILES | O=C(O)Cc1nn(Cc2nsc3ccccc23)c2ccc(Cl)cc12 |
| InChI | InChI=1S/C17H12ClN3O2S/c18-10-5-6-15-12(7-10)13(8-17(22)23)19-21(15)9-14-11-3-1-2-4-16(11)24-20-14/h1-7H,8-9H2,(H,22,23) |
| InChIKey | UVKKJDQLBKYKFH-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.82 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |