2,3-dianilino-5,6-dimethylterephthalic acid

C22H20N2O4 — CID 19027235

IUPAC2,3-dianilino-5,6-dimethylterephthalic acid
SMILESCc1c(C)c(C(=O)O)c(Nc2ccccc2)c(Nc2ccccc2)c1C(=O)O
InChIInChI=1S/C22H20N2O4/c1-13-14(2)18(22(27)28)20(24-16-11-7-4-8-12-16)19(17(13)21(25)26)23-15-9-5-3-6-10-15/h3-12,23-24H,1-2H3,(H,25,26)(H,27,28)
InChIKeyOERSSJHLKKAUHT-UHFFFAOYSA-N
MW376.41 g/mol
LogP5.19
Rot. Bonds6

About 2,3-dianilino-5,6-dimethylterephthalic acid

2,3-dianilino-5,6-dimethylterephthalic acid (PubChem CID 19027235) has the molecular formula C22H20N2O4 and a molecular weight of 376.41 g/mol. Its IUPAC name is 2,3-dianilino-5,6-dimethylterephthalic acid.

Molecular Properties

Compound Name2,3-dianilino-5,6-dimethylterephthalic acid
PubChem CID19027235
Molecular FormulaC22H20N2O4
Molecular Weight376.41 g/mol
Exact Mass376.14
IUPAC Name2,3-dianilino-5,6-dimethylterephthalic acid
SMILESCc1c(C)c(C(=O)O)c(Nc2ccccc2)c(Nc2ccccc2)c1C(=O)O
InChIInChI=1S/C22H20N2O4/c1-13-14(2)18(22(27)28)20(24-16-11-7-4-8-12-16)19(17(13)21(25)26)23-15-9-5-3-6-10-15/h3-12,23-24H,1-2H3,(H,25,26)(H,27,28)
InChIKeyOERSSJHLKKAUHT-UHFFFAOYSA-N
XLogP5.19
TPSA98.66 Ų
H-Bond Donors4
H-Bond Acceptors4
Rotatable Bonds6
Heavy Atoms28
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500376.41
LogP ≤ 55.19
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 104

Analyze 2,3-dianilino-5,6-dimethylterephthalic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,3-dianilino-5,6-dimethylterephthalic acid?
The IUPAC name of 2,3-dianilino-5,6-dimethylterephthalic acid (CID 19027235) is 2,3-dianilino-5,6-dimethylterephthalic acid.
What is the SMILES notation for 2,3-dianilino-5,6-dimethylterephthalic acid?
The canonical SMILES for 2,3-dianilino-5,6-dimethylterephthalic acid is Cc1c(C)c(C(=O)O)c(Nc2ccccc2)c(Nc2ccccc2)c1C(=O)O.
What is the InChIKey of 2,3-dianilino-5,6-dimethylterephthalic acid?
The InChIKey is OERSSJHLKKAUHT-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H20N2O4/c1-13-14(2)18(22(27)28)20(24-16-11-7-4-8-12-16)19(17(13)21(25)26)23-15-9-5-3-6-10-15/h3-12,23-24H,1-2H3,(H,25,26)(H,27,28).
What are the key properties of 2,3-dianilino-5,6-dimethylterephthalic acid?
2,3-dianilino-5,6-dimethylterephthalic acid has a molecular weight of 376.41 g/mol, XLogP of 5.19, 6 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dianilino-5,6-dimethylterephthalic acid is sourced from PubChem (CID 19027235), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).