C22H20N2O4 — CID 19027235
2,3-dianilino-5,6-dimethylterephthalic acid (PubChem CID 19027235) has the molecular formula C22H20N2O4 and a molecular weight of 376.41 g/mol. Its IUPAC name is 2,3-dianilino-5,6-dimethylterephthalic acid.
| Compound Name | 2,3-dianilino-5,6-dimethylterephthalic acid |
|---|---|
| PubChem CID | 19027235 |
| Molecular Formula | C22H20N2O4 |
| Molecular Weight | 376.41 g/mol |
| Exact Mass | 376.14 |
| IUPAC Name | 2,3-dianilino-5,6-dimethylterephthalic acid |
| SMILES | Cc1c(C)c(C(=O)O)c(Nc2ccccc2)c(Nc2ccccc2)c1C(=O)O |
| InChI | InChI=1S/C22H20N2O4/c1-13-14(2)18(22(27)28)20(24-16-11-7-4-8-12-16)19(17(13)21(25)26)23-15-9-5-3-6-10-15/h3-12,23-24H,1-2H3,(H,25,26)(H,27,28) |
| InChIKey | OERSSJHLKKAUHT-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.41 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |