C17H20O3 — CID 19028266
4-hydroxy-2-methyl-2-(4-methylcyclohex-3-en-1-yl)-3H-1-benzofuran-7-carbaldehyde (PubChem CID 19028266) has the molecular formula C17H20O3 and a molecular weight of 272.34 g/mol. Its IUPAC name is 4-hydroxy-2-methyl-2-(4-methylcyclohex-3-en-1-yl)-3H-1-benzofuran-7-carbaldehyde.
| Compound Name | 4-hydroxy-2-methyl-2-(4-methylcyclohex-3-en-1-yl)-3H-1-benzofuran-7-carbaldehyde |
|---|---|
| PubChem CID | 19028266 |
| Molecular Formula | C17H20O3 |
| Molecular Weight | 272.34 g/mol |
| Exact Mass | 272.14 |
| IUPAC Name | 4-hydroxy-2-methyl-2-(4-methylcyclohex-3-en-1-yl)-3H-1-benzofuran-7-carbaldehyde |
| SMILES | CC1=CCC(C2(C)Cc3c(O)ccc(C=O)c3O2)CC1 |
| InChI | InChI=1S/C17H20O3/c1-11-3-6-13(7-4-11)17(2)9-14-15(19)8-5-12(10-18)16(14)20-17/h3,5,8,10,13,19H,4,6-7,9H2,1-2H3 |
| InChIKey | FOJGVBBIKJXBHY-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.34 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|