C10H4ClN3O2 — CID 19030664
6-chloro-5H-pyridazino[4,5-b]indole-1,4-dione (PubChem CID 19030664) has the molecular formula C10H4ClN3O2 and a molecular weight of 233.61 g/mol. Its IUPAC name is 6-chloro-5H-pyridazino[4,5-b]indole-1,4-dione.
| Compound Name | 6-chloro-5H-pyridazino[4,5-b]indole-1,4-dione |
|---|---|
| PubChem CID | 19030664 |
| Molecular Formula | C10H4ClN3O2 |
| Molecular Weight | 233.61 g/mol |
| Exact Mass | 233.00 |
| IUPAC Name | 6-chloro-5H-pyridazino[4,5-b]indole-1,4-dione |
| SMILES | O=C1N=NC(=O)c2c1[nH]c1c(Cl)cccc21 |
| InChI | InChI=1S/C10H4ClN3O2/c11-5-3-1-2-4-6-8(12-7(4)5)10(16)14-13-9(6)15/h1-3,12H |
| InChIKey | QADVBGPKULGVAV-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 74.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.61 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |