C18H14ClF2NO2S — CID 19032482
chlorobenzene;ethyl 6,8-difluoro-4-sulfanylidene-1H-quinoline-3-carboxylate (PubChem CID 19032482) has the molecular formula C18H14ClF2NO2S and a molecular weight of 381.83 g/mol. Its IUPAC name is chlorobenzene;ethyl 6,8-difluoro-4-sulfanylidene-1H-quinoline-3-carboxylate.
| Compound Name | chlorobenzene;ethyl 6,8-difluoro-4-sulfanylidene-1H-quinoline-3-carboxylate |
|---|---|
| PubChem CID | 19032482 |
| Molecular Formula | C18H14ClF2NO2S |
| Molecular Weight | 381.83 g/mol |
| Exact Mass | 381.04 |
| IUPAC Name | chlorobenzene;ethyl 6,8-difluoro-4-sulfanylidene-1H-quinoline-3-carboxylate |
| SMILES | CCOC(=O)c1c[nH]c2c(F)cc(F)cc2c1=S.Clc1ccccc1 |
| InChI | InChI=1S/C12H9F2NO2S.C6H5Cl/c1-2-17-12(16)8-5-15-10-7(11(8)18)3-6(13)4-9(10)14;7-6-4-2-1-3-5-6/h3-5H,2H2,1H3,(H,15,18);1-5H |
| InChIKey | KZFVHKGOXCDQFI-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.83 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|