C20H31F2OSi — CID 19039059
CID 19039059 (PubChem CID 19039059) has the molecular formula C20H31F2OSi and a molecular weight of 353.55 g/mol.
| Compound Name | CID 19039059 |
|---|---|
| PubChem CID | 19039059 |
| Molecular Formula | C20H31F2OSi |
| Molecular Weight | 353.55 g/mol |
| Exact Mass | 353.21 |
| IUPAC Name | — |
| SMILES | CCCCC[Si]1CCC(COc2ccc(CCC)c(F)c2F)CC1 |
| InChI | InChI=1S/C20H31F2OSi/c1-3-5-6-12-24-13-10-16(11-14-24)15-23-18-9-8-17(7-4-2)19(21)20(18)22/h8-9,16H,3-7,10-15H2,1-2H3 |
| InChIKey | YYYJKWMSMDKTLI-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.55 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|