C22H39N3 — CID 19040187
4-diazo-N,N-dioctylcyclohexa-1,5-dien-1-amine (PubChem CID 19040187) has the molecular formula C22H39N3 and a molecular weight of 345.58 g/mol. Its IUPAC name is 4-diazo-N,N-dioctylcyclohexa-1,5-dien-1-amine.
| Compound Name | 4-diazo-N,N-dioctylcyclohexa-1,5-dien-1-amine |
|---|---|
| PubChem CID | 19040187 |
| Molecular Formula | C22H39N3 |
| Molecular Weight | 345.58 g/mol |
| Exact Mass | 345.31 |
| IUPAC Name | 4-diazo-N,N-dioctylcyclohexa-1,5-dien-1-amine |
| SMILES | CCCCCCCCN(CCCCCCCC)C1=CCC(=[N+]=[N-])C=C1 |
| InChI | InChI=1S/C22H39N3/c1-3-5-7-9-11-13-19-25(20-14-12-10-8-6-4-2)22-17-15-21(24-23)16-18-22/h15,17-18H,3-14,16,19-20H2,1-2H3 |
| InChIKey | HPIWQALQXMJUPD-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 39.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.58 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|