About 4-[4-(2,4-dichlorophenyl)-3-(difluoromethyl)-1-phenylpyrazol-5-yl]benzenesulfonamide
4-[4-(2,4-dichlorophenyl)-3-(difluoromethyl)-1-phenylpyrazol-5-yl]benzenesulfonamide (PubChem CID 19041342) has the molecular formula C22H15Cl2F2N3O2S
and a molecular weight of 494.35 g/mol. Its IUPAC name is 4-[4-(2,4-dichlorophenyl)-3-(difluoromethyl)-1-phenylpyrazol-5-yl]benzenesulfonamide.
Molecular Properties
| Compound Name | 4-[4-(2,4-dichlorophenyl)-3-(difluoromethyl)-1-phenylpyrazol-5-yl]benzenesulfonamide |
| PubChem CID | 19041342 |
| Molecular Formula | C22H15Cl2F2N3O2S |
| Molecular Weight | 494.35 g/mol |
| Exact Mass | 493.02 |
| IUPAC Name | 4-[4-(2,4-dichlorophenyl)-3-(difluoromethyl)-1-phenylpyrazol-5-yl]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(-c2c(-c3ccc(Cl)cc3Cl)c(C(F)F)nn2-c2ccccc2)cc1 |
| InChI | InChI=1S/C22H15Cl2F2N3O2S/c23-14-8-11-17(18(24)12-14)19-20(22(25)26)28-29(15-4-2-1-3-5-15)21(19)13-6-9-16(10-7-13)32(27,30)31/h1-12,22H,(H2,27,30,31) |
| InChIKey | QWBBGHGSMSNUIL-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 77.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 494.35 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[4-(2,4-dichlorophenyl)-3-(difluoromethyl)-1-phenylpyrazol-5-yl]benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-(2,4-dichlorophenyl)-3-(difluoromethyl)-1-phenylpyrazol-5-yl]benzenesulfonamide?
The IUPAC name of 4-[4-(2,4-dichlorophenyl)-3-(difluoromethyl)-1-phenylpyrazol-5-yl]benzenesulfonamide (CID 19041342) is 4-[4-(2,4-dichlorophenyl)-3-(difluoromethyl)-1-phenylpyrazol-5-yl]benzenesulfonamide.
What is the SMILES notation for 4-[4-(2,4-dichlorophenyl)-3-(difluoromethyl)-1-phenylpyrazol-5-yl]benzenesulfonamide?
The canonical SMILES for 4-[4-(2,4-dichlorophenyl)-3-(difluoromethyl)-1-phenylpyrazol-5-yl]benzenesulfonamide is NS(=O)(=O)c1ccc(-c2c(-c3ccc(Cl)cc3Cl)c(C(F)F)nn2-c2ccccc2)cc1.
What is the InChIKey of 4-[4-(2,4-dichlorophenyl)-3-(difluoromethyl)-1-phenylpyrazol-5-yl]benzenesulfonamide?
The InChIKey is QWBBGHGSMSNUIL-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H15Cl2F2N3O2S/c23-14-8-11-17(18(24)12-14)19-20(22(25)26)28-29(15-4-2-1-3-5-15)21(19)13-6-9-16(10-7-13)32(27,30)31/h1-12,22H,(H2,27,30,31).
What are the key properties of 4-[4-(2,4-dichlorophenyl)-3-(difluoromethyl)-1-phenylpyrazol-5-yl]benzenesulfonamide?
4-[4-(2,4-dichlorophenyl)-3-(difluoromethyl)-1-phenylpyrazol-5-yl]benzenesulfonamide has a molecular weight of 494.35 g/mol, XLogP of 6.10, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-(2,4-dichlorophenyl)-3-(difluoromethyl)-1-phenylpyrazol-5-yl]benzenesulfonamide is sourced from PubChem (CID 19041342), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).