C24H20F2N2O3S — CID 19041418
3-(difluoromethyl)-1-(4-methoxyphenyl)-5-(4-methylsulfonylphenyl)-4-phenylpyrazole (PubChem CID 19041418) has the molecular formula C24H20F2N2O3S and a molecular weight of 454.50 g/mol. Its IUPAC name is 3-(difluoromethyl)-1-(4-methoxyphenyl)-5-(4-methylsulfonylphenyl)-4-phenylpyrazole.
| Compound Name | 3-(difluoromethyl)-1-(4-methoxyphenyl)-5-(4-methylsulfonylphenyl)-4-phenylpyrazole |
|---|---|
| PubChem CID | 19041418 |
| Molecular Formula | C24H20F2N2O3S |
| Molecular Weight | 454.50 g/mol |
| Exact Mass | 454.12 |
| IUPAC Name | 3-(difluoromethyl)-1-(4-methoxyphenyl)-5-(4-methylsulfonylphenyl)-4-phenylpyrazole |
| SMILES | COc1ccc(-n2nc(C(F)F)c(-c3ccccc3)c2-c2ccc(S(C)(=O)=O)cc2)cc1 |
| InChI | InChI=1S/C24H20F2N2O3S/c1-31-19-12-10-18(11-13-19)28-23(17-8-14-20(15-9-17)32(2,29)30)21(22(27-28)24(25)26)16-6-4-3-5-7-16/h3-15,24H,1-2H3 |
| InChIKey | SLGWSDKKVZEZIF-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.50 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |