C10H16NO5PS — CID 19044113
4-(2-aminophenyl)sulfonylbutylphosphonic acid (PubChem CID 19044113) has the molecular formula C10H16NO5PS and a molecular weight of 293.28 g/mol. Its IUPAC name is 4-(2-aminophenyl)sulfonylbutylphosphonic acid.
| Compound Name | 4-(2-aminophenyl)sulfonylbutylphosphonic acid |
|---|---|
| PubChem CID | 19044113 |
| Molecular Formula | C10H16NO5PS |
| Molecular Weight | 293.28 g/mol |
| Exact Mass | 293.05 |
| IUPAC Name | 4-(2-aminophenyl)sulfonylbutylphosphonic acid |
| SMILES | Nc1ccccc1S(=O)(=O)CCCCP(=O)(O)O |
| InChI | InChI=1S/C10H16NO5PS/c11-9-5-1-2-6-10(9)18(15,16)8-4-3-7-17(12,13)14/h1-2,5-6H,3-4,7-8,11H2,(H2,12,13,14) |
| InChIKey | URFGSIVZIGQGOY-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 117.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.28 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|