C8H12NO8PS2 — CID 19834395
3-amino-4-(2-phosphonoethylsulfonyl)benzenesulfonic acid (PubChem CID 19834395) has the molecular formula C8H12NO8PS2 and a molecular weight of 345.29 g/mol. Its IUPAC name is 3-amino-4-(2-phosphonoethylsulfonyl)benzenesulfonic acid.
| Compound Name | 3-amino-4-(2-phosphonoethylsulfonyl)benzenesulfonic acid |
|---|---|
| PubChem CID | 19834395 |
| Molecular Formula | C8H12NO8PS2 |
| Molecular Weight | 345.29 g/mol |
| Exact Mass | 344.97 |
| IUPAC Name | 3-amino-4-(2-phosphonoethylsulfonyl)benzenesulfonic acid |
| SMILES | Nc1cc(S(=O)(=O)O)ccc1S(=O)(=O)CCP(=O)(O)O |
| InChI | InChI=1S/C8H12NO8PS2/c9-7-5-6(20(15,16)17)1-2-8(7)19(13,14)4-3-18(10,11)12/h1-2,5H,3-4,9H2,(H2,10,11,12)(H,15,16,17) |
| InChIKey | WZOZXRODAYCQNU-UHFFFAOYSA-N |
| XLogP | -0.53 |
| TPSA | 172.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.29 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|