C16H21N2O7PS2 — CID 67701425
2-(4-aminophenyl)sulfonylethylphosphonic acid;3-ethenylsulfonylaniline (PubChem CID 67701425) has the molecular formula C16H21N2O7PS2 and a molecular weight of 448.46 g/mol. Its IUPAC name is 2-(4-aminophenyl)sulfonylethylphosphonic acid;3-ethenylsulfonylaniline.
| Compound Name | 2-(4-aminophenyl)sulfonylethylphosphonic acid;3-ethenylsulfonylaniline |
|---|---|
| PubChem CID | 67701425 |
| Molecular Formula | C16H21N2O7PS2 |
| Molecular Weight | 448.46 g/mol |
| Exact Mass | 448.05 |
| IUPAC Name | 2-(4-aminophenyl)sulfonylethylphosphonic acid;3-ethenylsulfonylaniline |
| SMILES | C=CS(=O)(=O)c1cccc(N)c1.Nc1ccc(S(=O)(=O)CCP(=O)(O)O)cc1 |
| InChI | InChI=1S/C8H12NO5PS.C8H9NO2S/c9-7-1-3-8(4-2-7)16(13,14)6-5-15(10,11)12;1-2-12(10,11)8-5-3-4-7(9)6-8/h1-4H,5-6,9H2,(H2,10,11,12);2-6H,1,9H2 |
| InChIKey | RPXQVPBQAQVLIW-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 177.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.46 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|