C12H14NO5PS — CID 21424589
2-(6-aminonaphthalen-2-yl)sulfonylethylphosphonic acid (PubChem CID 21424589) has the molecular formula C12H14NO5PS and a molecular weight of 315.29 g/mol. Its IUPAC name is 2-(6-aminonaphthalen-2-yl)sulfonylethylphosphonic acid.
| Compound Name | 2-(6-aminonaphthalen-2-yl)sulfonylethylphosphonic acid |
|---|---|
| PubChem CID | 21424589 |
| Molecular Formula | C12H14NO5PS |
| Molecular Weight | 315.29 g/mol |
| Exact Mass | 315.03 |
| IUPAC Name | 2-(6-aminonaphthalen-2-yl)sulfonylethylphosphonic acid |
| SMILES | Nc1ccc2cc(S(=O)(=O)CCP(=O)(O)O)ccc2c1 |
| InChI | InChI=1S/C12H14NO5PS/c13-11-3-1-10-8-12(4-2-9(10)7-11)20(17,18)6-5-19(14,15)16/h1-4,7-8H,5-6,13H2,(H2,14,15,16) |
| InChIKey | QOQRRGRAOMGGEQ-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 117.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.29 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|