C11H18NO3P — CID 138720768
(5-amino-5-phenylpentyl)phosphonic acid (PubChem CID 138720768) has the molecular formula C11H18NO3P and a molecular weight of 243.24 g/mol. Its IUPAC name is (5-amino-5-phenylpentyl)phosphonic acid.
| Compound Name | (5-amino-5-phenylpentyl)phosphonic acid |
|---|---|
| PubChem CID | 138720768 |
| Molecular Formula | C11H18NO3P |
| Molecular Weight | 243.24 g/mol |
| Exact Mass | 243.10 |
| IUPAC Name | (5-amino-5-phenylpentyl)phosphonic acid |
| SMILES | NC(CCCCP(=O)(O)O)c1ccccc1 |
| InChI | InChI=1S/C11H18NO3P/c12-11(10-6-2-1-3-7-10)8-4-5-9-16(13,14)15/h1-3,6-7,11H,4-5,8-9,12H2,(H2,13,14,15) |
| InChIKey | LFYGFTIWWBPCOI-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.24 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|