C27H32N4O4 — CID 19056684
5-[2-[4-(furan-2-carbonyl)piperazin-1-yl]-2-oxoethyl]-6,9,9-trimethyl-6,8,10,11-tetrahydrobenzo[b][1,4]benzodiazepin-7-one (PubChem CID 19056684) has the molecular formula C27H32N4O4 and a molecular weight of 476.58 g/mol. Its IUPAC name is 5-[2-[4-(furan-2-carbonyl)piperazin-1-yl]-2-oxoethyl]-6,9,9-trimethyl-6,8,10,11-tetrahydrobenzo[b][1,4]benzodiazepin-7-one.
| Compound Name | 5-[2-[4-(furan-2-carbonyl)piperazin-1-yl]-2-oxoethyl]-6,9,9-trimethyl-6,8,10,11-tetrahydrobenzo[b][1,4]benzodiazepin-7-one |
|---|---|
| PubChem CID | 19056684 |
| Molecular Formula | C27H32N4O4 |
| Molecular Weight | 476.58 g/mol |
| Exact Mass | 476.24 |
| IUPAC Name | 5-[2-[4-(furan-2-carbonyl)piperazin-1-yl]-2-oxoethyl]-6,9,9-trimethyl-6,8,10,11-tetrahydrobenzo[b][1,4]benzodiazepin-7-one |
| SMILES | CC1C2=C(CC(C)(C)CC2=O)Nc2ccccc2N1CC(=O)N1CCN(C(=O)c2ccco2)CC1 |
| InChI | InChI=1S/C27H32N4O4/c1-18-25-20(15-27(2,3)16-22(25)32)28-19-7-4-5-8-21(19)31(18)17-24(33)29-10-12-30(13-11-29)26(34)23-9-6-14-35-23/h4-9,14,18,28H,10-13,15-17H2,1-3H3 |
| InChIKey | PGJAEFSJMVWQPF-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 86.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.58 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |