C33H37N3O3 — CID 19056510
5-[2-(4-benzylpiperidin-1-yl)-2-oxoethyl]-6-(furan-2-yl)-9,9-dimethyl-6,8,10,11-tetrahydrobenzo[b][1,4]benzodiazepin-7-one (PubChem CID 19056510) has the molecular formula C33H37N3O3 and a molecular weight of 523.68 g/mol. Its IUPAC name is 5-[2-(4-benzylpiperidin-1-yl)-2-oxoethyl]-6-(furan-2-yl)-9,9-dimethyl-6,8,10,11-tetrahydrobenzo[b][1,4]benzodiazepin-7-one.
| Compound Name | 5-[2-(4-benzylpiperidin-1-yl)-2-oxoethyl]-6-(furan-2-yl)-9,9-dimethyl-6,8,10,11-tetrahydrobenzo[b][1,4]benzodiazepin-7-one |
|---|---|
| PubChem CID | 19056510 |
| Molecular Formula | C33H37N3O3 |
| Molecular Weight | 523.68 g/mol |
| Exact Mass | 523.28 |
| IUPAC Name | 5-[2-(4-benzylpiperidin-1-yl)-2-oxoethyl]-6-(furan-2-yl)-9,9-dimethyl-6,8,10,11-tetrahydrobenzo[b][1,4]benzodiazepin-7-one |
| SMILES | CC1(C)CC(=O)C2=C(C1)Nc1ccccc1N(CC(=O)N1CCC(Cc3ccccc3)CC1)C2c1ccco1 |
| InChI | InChI=1S/C33H37N3O3/c1-33(2)20-26-31(28(37)21-33)32(29-13-8-18-39-29)36(27-12-7-6-11-25(27)34-26)22-30(38)35-16-14-24(15-17-35)19-23-9-4-3-5-10-23/h3-13,18,24,32,34H,14-17,19-22H2,1-2H3 |
| InChIKey | RMRPCLRGEJXQDU-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 65.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.68 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |