C41H42FN3O3 — CID 19056459
5-[2-(4-benzylpiperidin-1-yl)-2-oxoethyl]-6-(4-fluoro-3-phenoxyphenyl)-9,9-dimethyl-6,8,10,11-tetrahydrobenzo[b][1,4]benzodiazepin-7-one (PubChem CID 19056459) has the molecular formula C41H42FN3O3 and a molecular weight of 643.80 g/mol. Its IUPAC name is 5-[2-(4-benzylpiperidin-1-yl)-2-oxoethyl]-6-(4-fluoro-3-phenoxyphenyl)-9,9-dimethyl-6,8,10,11-tetrahydrobenzo[b][1,4]benzodiazepin-7-one.
| Compound Name | 5-[2-(4-benzylpiperidin-1-yl)-2-oxoethyl]-6-(4-fluoro-3-phenoxyphenyl)-9,9-dimethyl-6,8,10,11-tetrahydrobenzo[b][1,4]benzodiazepin-7-one |
|---|---|
| PubChem CID | 19056459 |
| Molecular Formula | C41H42FN3O3 |
| Molecular Weight | 643.80 g/mol |
| Exact Mass | 643.32 |
| IUPAC Name | 5-[2-(4-benzylpiperidin-1-yl)-2-oxoethyl]-6-(4-fluoro-3-phenoxyphenyl)-9,9-dimethyl-6,8,10,11-tetrahydrobenzo[b][1,4]benzodiazepin-7-one |
| SMILES | CC1(C)CC(=O)C2=C(C1)Nc1ccccc1N(CC(=O)N1CCC(Cc3ccccc3)CC1)C2c1ccc(F)c(Oc2ccccc2)c1 |
| InChI | InChI=1S/C41H42FN3O3/c1-41(2)25-34-39(36(46)26-41)40(30-17-18-32(42)37(24-30)48-31-13-7-4-8-14-31)45(35-16-10-9-15-33(35)43-34)27-38(47)44-21-19-29(20-22-44)23-28-11-5-3-6-12-28/h3-18,24,29,40,43H,19-23,25-27H2,1-2H3 |
| InChIKey | OUZWMHJGCVUYET-UHFFFAOYSA-N |
| XLogP | 8.72 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.80 |
| LogP ≤ 5 | 8.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |