C42H45N3O3 — CID 19055134
5-[2-[4-[hydroxy(diphenyl)methyl]piperidin-1-yl]-2-oxoethyl]-9,9-dimethyl-6-(4-methylphenyl)-6,8,10,11-tetrahydrobenzo[b][1,4]benzodiazepin-7-one (PubChem CID 19055134) has the molecular formula C42H45N3O3 and a molecular weight of 639.84 g/mol. Its IUPAC name is 5-[2-[4-[hydroxy(diphenyl)methyl]piperidin-1-yl]-2-oxoethyl]-9,9-dimethyl-6-(4-methylphenyl)-6,8,10,11-tetrahydrobenzo[b][1,4]benzodiazepin-7-one.
| Compound Name | 5-[2-[4-[hydroxy(diphenyl)methyl]piperidin-1-yl]-2-oxoethyl]-9,9-dimethyl-6-(4-methylphenyl)-6,8,10,11-tetrahydrobenzo[b][1,4]benzodiazepin-7-one |
|---|---|
| PubChem CID | 19055134 |
| Molecular Formula | C42H45N3O3 |
| Molecular Weight | 639.84 g/mol |
| Exact Mass | 639.35 |
| IUPAC Name | 5-[2-[4-[hydroxy(diphenyl)methyl]piperidin-1-yl]-2-oxoethyl]-9,9-dimethyl-6-(4-methylphenyl)-6,8,10,11-tetrahydrobenzo[b][1,4]benzodiazepin-7-one |
| SMILES | Cc1ccc(C2C3=C(CC(C)(C)CC3=O)Nc3ccccc3N2CC(=O)N2CCC(C(O)(c3ccccc3)c3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C42H45N3O3/c1-29-18-20-30(21-19-29)40-39-35(26-41(2,3)27-37(39)46)43-34-16-10-11-17-36(34)45(40)28-38(47)44-24-22-33(23-25-44)42(48,31-12-6-4-7-13-31)32-14-8-5-9-15-32/h4-21,33,40,43,48H,22-28H2,1-3H3 |
| InChIKey | DCJUIIDDGQKSEQ-UHFFFAOYSA-N |
| XLogP | 7.79 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.84 |
| LogP ≤ 5 | 7.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |