C47H46FN3O4 — CID 19056461
6-(4-fluoro-3-phenoxyphenyl)-5-[2-[4-[hydroxy(diphenyl)methyl]piperidin-1-yl]-2-oxoethyl]-9,9-dimethyl-6,8,10,11-tetrahydrobenzo[b][1,4]benzodiazepin-7-one (PubChem CID 19056461) has the molecular formula C47H46FN3O4 and a molecular weight of 735.90 g/mol. Its IUPAC name is 6-(4-fluoro-3-phenoxyphenyl)-5-[2-[4-[hydroxy(diphenyl)methyl]piperidin-1-yl]-2-oxoethyl]-9,9-dimethyl-6,8,10,11-tetrahydrobenzo[b][1,4]benzodiazepin-7-one.
| Compound Name | 6-(4-fluoro-3-phenoxyphenyl)-5-[2-[4-[hydroxy(diphenyl)methyl]piperidin-1-yl]-2-oxoethyl]-9,9-dimethyl-6,8,10,11-tetrahydrobenzo[b][1,4]benzodiazepin-7-one |
|---|---|
| PubChem CID | 19056461 |
| Molecular Formula | C47H46FN3O4 |
| Molecular Weight | 735.90 g/mol |
| Exact Mass | 735.35 |
| IUPAC Name | 6-(4-fluoro-3-phenoxyphenyl)-5-[2-[4-[hydroxy(diphenyl)methyl]piperidin-1-yl]-2-oxoethyl]-9,9-dimethyl-6,8,10,11-tetrahydrobenzo[b][1,4]benzodiazepin-7-one |
| SMILES | CC1(C)CC(=O)C2=C(C1)Nc1ccccc1N(CC(=O)N1CCC(C(O)(c3ccccc3)c3ccccc3)CC1)C2c1ccc(F)c(Oc2ccccc2)c1 |
| InChI | InChI=1S/C47H46FN3O4/c1-46(2)29-39-44(41(52)30-46)45(32-22-23-37(48)42(28-32)55-36-18-10-5-11-19-36)51(40-21-13-12-20-38(40)49-39)31-43(53)50-26-24-35(25-27-50)47(54,33-14-6-3-7-15-33)34-16-8-4-9-17-34/h3-23,28,35,45,49,54H,24-27,29-31H2,1-2H3 |
| InChIKey | PATPZYBIQPAUGV-UHFFFAOYSA-N |
| XLogP | 9.41 |
| TPSA | 82.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 735.90 |
| LogP ≤ 5 | 9.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |