C30H37N3O2 — CID 41090324
(6S)-5-[2-(4-benzylpiperidin-1-yl)-2-oxoethyl]-6,9,9-trimethyl-6,8,10,11-tetrahydrobenzo[b][1,4]benzodiazepin-7-one (PubChem CID 41090324) has the molecular formula C30H37N3O2 and a molecular weight of 471.65 g/mol. Its IUPAC name is (6S)-5-[2-(4-benzylpiperidin-1-yl)-2-oxoethyl]-6,9,9-trimethyl-6,8,10,11-tetrahydrobenzo[b][1,4]benzodiazepin-7-one.
| Compound Name | (6S)-5-[2-(4-benzylpiperidin-1-yl)-2-oxoethyl]-6,9,9-trimethyl-6,8,10,11-tetrahydrobenzo[b][1,4]benzodiazepin-7-one |
|---|---|
| PubChem CID | 41090324 |
| Molecular Formula | C30H37N3O2 |
| Molecular Weight | 471.65 g/mol |
| Exact Mass | 471.29 |
| IUPAC Name | (6S)-5-[2-(4-benzylpiperidin-1-yl)-2-oxoethyl]-6,9,9-trimethyl-6,8,10,11-tetrahydrobenzo[b][1,4]benzodiazepin-7-one |
| SMILES | C[C@H]1C2=C(CC(C)(C)CC2=O)Nc2ccccc2N1CC(=O)N1CCC(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C30H37N3O2/c1-21-29-25(18-30(2,3)19-27(29)34)31-24-11-7-8-12-26(24)33(21)20-28(35)32-15-13-23(14-16-32)17-22-9-5-4-6-10-22/h4-12,21,23,31H,13-20H2,1-3H3/t21-/m0/s1 |
| InChIKey | QCPHOEPXQHPWBE-NRFANRHFSA-N |
| XLogP | 5.43 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.65 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |