C27H26FN3O4S2 — CID 19057159
[5-[(Z)-2-benzamido-3-[2-(3-fluorophenyl)ethylamino]-3-oxoprop-1-enyl]furan-2-yl] morpholine-4-carbodithioate (PubChem CID 19057159) has the molecular formula C27H26FN3O4S2 and a molecular weight of 539.65 g/mol. Its IUPAC name is [5-[(Z)-2-benzamido-3-[2-(3-fluorophenyl)ethylamino]-3-oxoprop-1-enyl]furan-2-yl] morpholine-4-carbodithioate.
| Compound Name | [5-[(Z)-2-benzamido-3-[2-(3-fluorophenyl)ethylamino]-3-oxoprop-1-enyl]furan-2-yl] morpholine-4-carbodithioate |
|---|---|
| PubChem CID | 19057159 |
| Molecular Formula | C27H26FN3O4S2 |
| Molecular Weight | 539.65 g/mol |
| Exact Mass | 539.13 |
| IUPAC Name | [5-[(Z)-2-benzamido-3-[2-(3-fluorophenyl)ethylamino]-3-oxoprop-1-enyl]furan-2-yl] morpholine-4-carbodithioate |
| SMILES | O=C(NCCc1cccc(F)c1)/C(=C/c1ccc(SC(=S)N2CCOCC2)o1)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C27H26FN3O4S2/c28-21-8-4-5-19(17-21)11-12-29-26(33)23(30-25(32)20-6-2-1-3-7-20)18-22-9-10-24(35-22)37-27(36)31-13-15-34-16-14-31/h1-10,17-18H,11-16H2,(H,29,33)(H,30,32)/b23-18- |
| InChIKey | XDQLCGGZWDBXTD-NKFKGCMQSA-N |
| XLogP | 4.26 |
| TPSA | 83.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.65 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|