C28H29N5O4S2 — CID 124656548
[5-[(E)-2-benzamido-3-oxo-3-(4-pyridin-2-ylpiperazin-1-yl)prop-1-enyl]furan-2-yl] morpholine-4-carbodithioate (PubChem CID 124656548) has the molecular formula C28H29N5O4S2 and a molecular weight of 563.71 g/mol. Its IUPAC name is [5-[(E)-2-benzamido-3-oxo-3-(4-pyridin-2-ylpiperazin-1-yl)prop-1-enyl]furan-2-yl] morpholine-4-carbodithioate.
| Compound Name | [5-[(E)-2-benzamido-3-oxo-3-(4-pyridin-2-ylpiperazin-1-yl)prop-1-enyl]furan-2-yl] morpholine-4-carbodithioate |
|---|---|
| PubChem CID | 124656548 |
| Molecular Formula | C28H29N5O4S2 |
| Molecular Weight | 563.71 g/mol |
| Exact Mass | 563.17 |
| IUPAC Name | [5-[(E)-2-benzamido-3-oxo-3-(4-pyridin-2-ylpiperazin-1-yl)prop-1-enyl]furan-2-yl] morpholine-4-carbodithioate |
| SMILES | O=C(N/C(=C/c1ccc(SC(=S)N2CCOCC2)o1)C(=O)N1CCN(c2ccccn2)CC1)c1ccccc1 |
| InChI | InChI=1S/C28H29N5O4S2/c34-26(21-6-2-1-3-7-21)30-23(27(35)32-14-12-31(13-15-32)24-8-4-5-11-29-24)20-22-9-10-25(37-22)39-28(38)33-16-18-36-19-17-33/h1-11,20H,12-19H2,(H,30,34)/b23-20+ |
| InChIKey | MGZXJDSLWOEOGX-BSYVCWPDSA-N |
| XLogP | 3.50 |
| TPSA | 91.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.71 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|