C27H25N5O2 — CID 124658282
N-[(E)-1-(1H-indol-3-yl)-3-oxo-3-(4-pyridin-2-ylpiperazin-1-yl)prop-1-en-2-yl]benzamide (PubChem CID 124658282) has the molecular formula C27H25N5O2 and a molecular weight of 451.53 g/mol. Its IUPAC name is N-[(E)-1-(1H-indol-3-yl)-3-oxo-3-(4-pyridin-2-ylpiperazin-1-yl)prop-1-en-2-yl]benzamide.
| Compound Name | N-[(E)-1-(1H-indol-3-yl)-3-oxo-3-(4-pyridin-2-ylpiperazin-1-yl)prop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 124658282 |
| Molecular Formula | C27H25N5O2 |
| Molecular Weight | 451.53 g/mol |
| Exact Mass | 451.20 |
| IUPAC Name | N-[(E)-1-(1H-indol-3-yl)-3-oxo-3-(4-pyridin-2-ylpiperazin-1-yl)prop-1-en-2-yl]benzamide |
| SMILES | O=C(N/C(=C/c1c[nH]c2ccccc12)C(=O)N1CCN(c2ccccn2)CC1)c1ccccc1 |
| InChI | InChI=1S/C27H25N5O2/c33-26(20-8-2-1-3-9-20)30-24(18-21-19-29-23-11-5-4-10-22(21)23)27(34)32-16-14-31(15-17-32)25-12-6-7-13-28-25/h1-13,18-19,29H,14-17H2,(H,30,33)/b24-18+ |
| InChIKey | YGVJYMBCLAZOGW-HKOYGPOVSA-N |
| XLogP | 3.68 |
| TPSA | 81.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.53 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|