C24H24N4O3 — CID 86942402
N-[(Z)-1-(furan-2-yl)-3-oxo-3-[(1-pyridin-2-ylpiperidin-4-yl)amino]prop-1-en-2-yl]benzamide (PubChem CID 86942402) has the molecular formula C24H24N4O3 and a molecular weight of 416.48 g/mol. Its IUPAC name is N-[(Z)-1-(furan-2-yl)-3-oxo-3-[(1-pyridin-2-ylpiperidin-4-yl)amino]prop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-1-(furan-2-yl)-3-oxo-3-[(1-pyridin-2-ylpiperidin-4-yl)amino]prop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 86942402 |
| Molecular Formula | C24H24N4O3 |
| Molecular Weight | 416.48 g/mol |
| Exact Mass | 416.18 |
| IUPAC Name | N-[(Z)-1-(furan-2-yl)-3-oxo-3-[(1-pyridin-2-ylpiperidin-4-yl)amino]prop-1-en-2-yl]benzamide |
| SMILES | O=C(NC1CCN(c2ccccn2)CC1)/C(=C/c1ccco1)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C24H24N4O3/c29-23(18-7-2-1-3-8-18)27-21(17-20-9-6-16-31-20)24(30)26-19-11-14-28(15-12-19)22-10-4-5-13-25-22/h1-10,13,16-17,19H,11-12,14-15H2,(H,26,30)(H,27,29)/b21-17- |
| InChIKey | UXEQZHCYBMZSAN-FXBPSFAMSA-N |
| XLogP | 3.23 |
| TPSA | 87.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.48 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|