C23H20N2O3S — CID 86942397
N-[(Z)-3-(3,4-dihydro-2H-thiochromen-4-ylamino)-1-(furan-2-yl)-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 86942397) has the molecular formula C23H20N2O3S and a molecular weight of 404.49 g/mol. Its IUPAC name is N-[(Z)-3-(3,4-dihydro-2H-thiochromen-4-ylamino)-1-(furan-2-yl)-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-3-(3,4-dihydro-2H-thiochromen-4-ylamino)-1-(furan-2-yl)-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 86942397 |
| Molecular Formula | C23H20N2O3S |
| Molecular Weight | 404.49 g/mol |
| Exact Mass | 404.12 |
| IUPAC Name | N-[(Z)-3-(3,4-dihydro-2H-thiochromen-4-ylamino)-1-(furan-2-yl)-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | O=C(NC1CCSc2ccccc21)/C(=C/c1ccco1)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C23H20N2O3S/c26-22(16-7-2-1-3-8-16)25-20(15-17-9-6-13-28-17)23(27)24-19-12-14-29-21-11-5-4-10-18(19)21/h1-11,13,15,19H,12,14H2,(H,24,27)(H,25,26)/b20-15- |
| InChIKey | YEJJVTXTPSPJAV-HKWRFOASSA-N |
| XLogP | 4.40 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.49 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|