C27H33N3O4S2 — CID 19057157
[5-[(Z)-2-benzamido-3-(cyclooctylamino)-3-oxoprop-1-enyl]furan-2-yl] morpholine-4-carbodithioate (PubChem CID 19057157) has the molecular formula C27H33N3O4S2 and a molecular weight of 527.71 g/mol. Its IUPAC name is [5-[(Z)-2-benzamido-3-(cyclooctylamino)-3-oxoprop-1-enyl]furan-2-yl] morpholine-4-carbodithioate.
| Compound Name | [5-[(Z)-2-benzamido-3-(cyclooctylamino)-3-oxoprop-1-enyl]furan-2-yl] morpholine-4-carbodithioate |
|---|---|
| PubChem CID | 19057157 |
| Molecular Formula | C27H33N3O4S2 |
| Molecular Weight | 527.71 g/mol |
| Exact Mass | 527.19 |
| IUPAC Name | [5-[(Z)-2-benzamido-3-(cyclooctylamino)-3-oxoprop-1-enyl]furan-2-yl] morpholine-4-carbodithioate |
| SMILES | O=C(NC1CCCCCCC1)/C(=C/c1ccc(SC(=S)N2CCOCC2)o1)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C27H33N3O4S2/c31-25(20-9-5-4-6-10-20)29-23(26(32)28-21-11-7-2-1-3-8-12-21)19-22-13-14-24(34-22)36-27(35)30-15-17-33-18-16-30/h4-6,9-10,13-14,19,21H,1-3,7-8,11-12,15-18H2,(H,28,32)(H,29,31)/b23-19- |
| InChIKey | HHEFGRNXHOVRNJ-NMWGTECJSA-N |
| XLogP | 4.99 |
| TPSA | 83.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.71 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|