C24H21FIN3O3 — CID 19057176
N-[(Z)-3-[4-(4-fluorophenyl)piperazin-1-yl]-1-(5-iodofuran-2-yl)-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 19057176) has the molecular formula C24H21FIN3O3 and a molecular weight of 545.35 g/mol. Its IUPAC name is N-[(Z)-3-[4-(4-fluorophenyl)piperazin-1-yl]-1-(5-iodofuran-2-yl)-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-3-[4-(4-fluorophenyl)piperazin-1-yl]-1-(5-iodofuran-2-yl)-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 19057176 |
| Molecular Formula | C24H21FIN3O3 |
| Molecular Weight | 545.35 g/mol |
| Exact Mass | 545.06 |
| IUPAC Name | N-[(Z)-3-[4-(4-fluorophenyl)piperazin-1-yl]-1-(5-iodofuran-2-yl)-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | O=C(N/C(=C\c1ccc(I)o1)C(=O)N1CCN(c2ccc(F)cc2)CC1)c1ccccc1 |
| InChI | InChI=1S/C24H21FIN3O3/c25-18-6-8-19(9-7-18)28-12-14-29(15-13-28)24(31)21(16-20-10-11-22(26)32-20)27-23(30)17-4-2-1-3-5-17/h1-11,16H,12-15H2,(H,27,30)/b21-16- |
| InChIKey | BYFMPWAGEFCPQG-PGMHBOJBSA-N |
| XLogP | 4.14 |
| TPSA | 65.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.35 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|