C32H25NO6 — CID 19057224
[2-(9H-fluoren-2-yl)-2-oxoethyl] 4-[4-[(E)-3-(furan-2-yl)prop-2-enoyl]anilino]-4-oxobutanoate (PubChem CID 19057224) has the molecular formula C32H25NO6 and a molecular weight of 519.55 g/mol. Its IUPAC name is [2-(9H-fluoren-2-yl)-2-oxoethyl] 4-[4-[(E)-3-(furan-2-yl)prop-2-enoyl]anilino]-4-oxobutanoate.
| Compound Name | [2-(9H-fluoren-2-yl)-2-oxoethyl] 4-[4-[(E)-3-(furan-2-yl)prop-2-enoyl]anilino]-4-oxobutanoate |
|---|---|
| PubChem CID | 19057224 |
| Molecular Formula | C32H25NO6 |
| Molecular Weight | 519.55 g/mol |
| Exact Mass | 519.17 |
| IUPAC Name | [2-(9H-fluoren-2-yl)-2-oxoethyl] 4-[4-[(E)-3-(furan-2-yl)prop-2-enoyl]anilino]-4-oxobutanoate |
| SMILES | O=C(CCC(=O)OCC(=O)c1ccc2c(c1)Cc1ccccc1-2)Nc1ccc(C(=O)/C=C/c2ccco2)cc1 |
| InChI | InChI=1S/C32H25NO6/c34-29(14-12-26-5-3-17-38-26)21-7-10-25(11-8-21)33-31(36)15-16-32(37)39-20-30(35)23-9-13-28-24(19-23)18-22-4-1-2-6-27(22)28/h1-14,17,19H,15-16,18,20H2,(H,33,36)/b14-12+ |
| InChIKey | WCEOPJQLXBGLOU-WYMLVPIESA-N |
| XLogP | 5.89 |
| TPSA | 102.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.55 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|