C27H26O4 — CID 7855454
[2-(9H-fluoren-3-yl)-2-oxoethyl] 2-(4-tert-butylphenoxy)acetate (PubChem CID 7855454) has the molecular formula C27H26O4 and a molecular weight of 414.50 g/mol. Its IUPAC name is [2-(9H-fluoren-3-yl)-2-oxoethyl] 2-(4-tert-butylphenoxy)acetate.
| Compound Name | [2-(9H-fluoren-3-yl)-2-oxoethyl] 2-(4-tert-butylphenoxy)acetate |
|---|---|
| PubChem CID | 7855454 |
| Molecular Formula | C27H26O4 |
| Molecular Weight | 414.50 g/mol |
| Exact Mass | 414.18 |
| IUPAC Name | [2-(9H-fluoren-3-yl)-2-oxoethyl] 2-(4-tert-butylphenoxy)acetate |
| SMILES | CC(C)(C)c1ccc(OCC(=O)OCC(=O)c2ccc3c(c2)-c2ccccc2C3)cc1 |
| InChI | InChI=1S/C27H26O4/c1-27(2,3)21-10-12-22(13-11-21)30-17-26(29)31-16-25(28)20-9-8-19-14-18-6-4-5-7-23(18)24(19)15-20/h4-13,15H,14,16-17H2,1-3H3 |
| InChIKey | UPMYFCITHDQNOS-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.50 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |