C21H16N2O5 — CID 7632864
[2-(9H-fluoren-3-yl)-2-oxoethyl] 2-(2,4-dioxopyrimidin-1-yl)acetate (PubChem CID 7632864) has the molecular formula C21H16N2O5 and a molecular weight of 376.37 g/mol. Its IUPAC name is [2-(9H-fluoren-3-yl)-2-oxoethyl] 2-(2,4-dioxopyrimidin-1-yl)acetate.
| Compound Name | [2-(9H-fluoren-3-yl)-2-oxoethyl] 2-(2,4-dioxopyrimidin-1-yl)acetate |
|---|---|
| PubChem CID | 7632864 |
| Molecular Formula | C21H16N2O5 |
| Molecular Weight | 376.37 g/mol |
| Exact Mass | 376.11 |
| IUPAC Name | [2-(9H-fluoren-3-yl)-2-oxoethyl] 2-(2,4-dioxopyrimidin-1-yl)acetate |
| SMILES | O=C(Cn1ccc(=O)[nH]c1=O)OCC(=O)c1ccc2c(c1)-c1ccccc1C2 |
| InChI | InChI=1S/C21H16N2O5/c24-18(12-28-20(26)11-23-8-7-19(25)22-21(23)27)15-6-5-14-9-13-3-1-2-4-16(13)17(14)10-15/h1-8,10H,9,11-12H2,(H,22,25,27) |
| InChIKey | ITRFNVPHVTXUJL-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 98.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.37 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |