C16H13N3O6 — CID 7632681
2-(1,3-dioxoisoindol-2-yl)ethyl 2-(2,4-dioxopyrimidin-1-yl)acetate (PubChem CID 7632681) has the molecular formula C16H13N3O6 and a molecular weight of 343.30 g/mol. Its IUPAC name is 2-(1,3-dioxoisoindol-2-yl)ethyl 2-(2,4-dioxopyrimidin-1-yl)acetate.
| Compound Name | 2-(1,3-dioxoisoindol-2-yl)ethyl 2-(2,4-dioxopyrimidin-1-yl)acetate |
|---|---|
| PubChem CID | 7632681 |
| Molecular Formula | C16H13N3O6 |
| Molecular Weight | 343.30 g/mol |
| Exact Mass | 343.08 |
| IUPAC Name | 2-(1,3-dioxoisoindol-2-yl)ethyl 2-(2,4-dioxopyrimidin-1-yl)acetate |
| SMILES | O=C(Cn1ccc(=O)[nH]c1=O)OCCN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C16H13N3O6/c20-12-5-6-18(16(24)17-12)9-13(21)25-8-7-19-14(22)10-3-1-2-4-11(10)15(19)23/h1-6H,7-9H2,(H,17,20,24) |
| InChIKey | OTHBLRGHWODIBU-UHFFFAOYSA-N |
| XLogP | -0.62 |
| TPSA | 118.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.30 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|