C13H22N3O4+ — CID 19064101
hydroxy-(2-hydroxypropyl)-methyl-[2-nitro-4-(propylamino)phenyl]azanium (PubChem CID 19064101) has the molecular formula C13H22N3O4+ and a molecular weight of 284.34 g/mol. Its IUPAC name is hydroxy-(2-hydroxypropyl)-methyl-[2-nitro-4-(propylamino)phenyl]azanium.
| Compound Name | hydroxy-(2-hydroxypropyl)-methyl-[2-nitro-4-(propylamino)phenyl]azanium |
|---|---|
| PubChem CID | 19064101 |
| Molecular Formula | C13H22N3O4+ |
| Molecular Weight | 284.34 g/mol |
| Exact Mass | 284.16 |
| IUPAC Name | hydroxy-(2-hydroxypropyl)-methyl-[2-nitro-4-(propylamino)phenyl]azanium |
| SMILES | CCCNc1ccc([N+](C)(O)CC(C)O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C13H22N3O4/c1-4-7-14-11-5-6-13(12(8-11)15(18)19)16(3,20)9-10(2)17/h5-6,8,10,14,17,20H,4,7,9H2,1-3H3/q+1 |
| InChIKey | XTRVWRYAUNCOHQ-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 95.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.34 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|