C14H25ClN3O5+ — CID 19064120
dihydroxy-(3-hydroxypropyl)-[4-(2-methylbutylamino)-2-nitrophenyl]azanium;hydrochloride (PubChem CID 19064120) has the molecular formula C14H25ClN3O5+ and a molecular weight of 350.82 g/mol. Its IUPAC name is dihydroxy-(3-hydroxypropyl)-[4-(2-methylbutylamino)-2-nitrophenyl]azanium;hydrochloride.
| Compound Name | dihydroxy-(3-hydroxypropyl)-[4-(2-methylbutylamino)-2-nitrophenyl]azanium;hydrochloride |
|---|---|
| PubChem CID | 19064120 |
| Molecular Formula | C14H25ClN3O5+ |
| Molecular Weight | 350.82 g/mol |
| Exact Mass | 350.15 |
| IUPAC Name | dihydroxy-(3-hydroxypropyl)-[4-(2-methylbutylamino)-2-nitrophenyl]azanium;hydrochloride |
| SMILES | CCC(C)CNc1ccc([N+](O)(O)CCCO)c([N+](=O)[O-])c1.Cl |
| InChI | InChI=1S/C14H24N3O5.ClH/c1-3-11(2)10-15-12-5-6-14(13(9-12)16(19)20)17(21,22)7-4-8-18;/h5-6,9,11,15,18,21-22H,3-4,7-8,10H2,1-2H3;1H/q+1; |
| InChIKey | RYJXDRLATOKVPM-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 115.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.82 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|