C27H34N2O2S — CID 19064626
N-[3-(1-tert-butylpiperidin-4-yl)-1-benzothiophen-5-yl]-2-propoxybenzamide (PubChem CID 19064626) has the molecular formula C27H34N2O2S and a molecular weight of 450.65 g/mol. Its IUPAC name is N-[3-(1-tert-butylpiperidin-4-yl)-1-benzothiophen-5-yl]-2-propoxybenzamide.
| Compound Name | N-[3-(1-tert-butylpiperidin-4-yl)-1-benzothiophen-5-yl]-2-propoxybenzamide |
|---|---|
| PubChem CID | 19064626 |
| Molecular Formula | C27H34N2O2S |
| Molecular Weight | 450.65 g/mol |
| Exact Mass | 450.23 |
| IUPAC Name | N-[3-(1-tert-butylpiperidin-4-yl)-1-benzothiophen-5-yl]-2-propoxybenzamide |
| SMILES | CCCOc1ccccc1C(=O)Nc1ccc2scc(C3CCN(C(C)(C)C)CC3)c2c1 |
| InChI | InChI=1S/C27H34N2O2S/c1-5-16-31-24-9-7-6-8-21(24)26(30)28-20-10-11-25-22(17-20)23(18-32-25)19-12-14-29(15-13-19)27(2,3)4/h6-11,17-19H,5,12-16H2,1-4H3,(H,28,30) |
| InChIKey | RMRASIHSLGLXHA-UHFFFAOYSA-N |
| XLogP | 6.92 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.65 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |