C26H32N2OS — CID 19064722
2-ethyl-N-[3-[1-(2-methylpropyl)piperidin-4-yl]-1-benzothiophen-5-yl]benzamide (PubChem CID 19064722) has the molecular formula C26H32N2OS and a molecular weight of 420.62 g/mol. Its IUPAC name is 2-ethyl-N-[3-[1-(2-methylpropyl)piperidin-4-yl]-1-benzothiophen-5-yl]benzamide.
| Compound Name | 2-ethyl-N-[3-[1-(2-methylpropyl)piperidin-4-yl]-1-benzothiophen-5-yl]benzamide |
|---|---|
| PubChem CID | 19064722 |
| Molecular Formula | C26H32N2OS |
| Molecular Weight | 420.62 g/mol |
| Exact Mass | 420.22 |
| IUPAC Name | 2-ethyl-N-[3-[1-(2-methylpropyl)piperidin-4-yl]-1-benzothiophen-5-yl]benzamide |
| SMILES | CCc1ccccc1C(=O)Nc1ccc2scc(C3CCN(CC(C)C)CC3)c2c1 |
| InChI | InChI=1S/C26H32N2OS/c1-4-19-7-5-6-8-22(19)26(29)27-21-9-10-25-23(15-21)24(17-30-25)20-11-13-28(14-12-20)16-18(2)3/h5-10,15,17-18,20H,4,11-14,16H2,1-3H3,(H,27,29) |
| InChIKey | DCVXQMBYZJSTPO-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.62 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |