C24H34N2O3S — CID 19064588
propyl 2-methyl-3-[[3-[1-(2-methylpropyl)piperidin-4-yl]-1-benzothiophen-5-yl]amino]-3-oxopropanoate (PubChem CID 19064588) has the molecular formula C24H34N2O3S and a molecular weight of 430.61 g/mol. Its IUPAC name is propyl 2-methyl-3-[[3-[1-(2-methylpropyl)piperidin-4-yl]-1-benzothiophen-5-yl]amino]-3-oxopropanoate.
| Compound Name | propyl 2-methyl-3-[[3-[1-(2-methylpropyl)piperidin-4-yl]-1-benzothiophen-5-yl]amino]-3-oxopropanoate |
|---|---|
| PubChem CID | 19064588 |
| Molecular Formula | C24H34N2O3S |
| Molecular Weight | 430.61 g/mol |
| Exact Mass | 430.23 |
| IUPAC Name | propyl 2-methyl-3-[[3-[1-(2-methylpropyl)piperidin-4-yl]-1-benzothiophen-5-yl]amino]-3-oxopropanoate |
| SMILES | CCCOC(=O)C(C)C(=O)Nc1ccc2scc(C3CCN(CC(C)C)CC3)c2c1 |
| InChI | InChI=1S/C24H34N2O3S/c1-5-12-29-24(28)17(4)23(27)25-19-6-7-22-20(13-19)21(15-30-22)18-8-10-26(11-9-18)14-16(2)3/h6-7,13,15-18H,5,8-12,14H2,1-4H3,(H,25,27) |
| InChIKey | VTTSXEDYZVSQLG-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.61 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|