C25H30N2O3S2 — CID 19064706
N-[3-(1-butylpiperidin-4-yl)-1-benzothiophen-5-yl]-2-methylsulfonylbenzamide (PubChem CID 19064706) has the molecular formula C25H30N2O3S2 and a molecular weight of 470.66 g/mol. Its IUPAC name is N-[3-(1-butylpiperidin-4-yl)-1-benzothiophen-5-yl]-2-methylsulfonylbenzamide.
| Compound Name | N-[3-(1-butylpiperidin-4-yl)-1-benzothiophen-5-yl]-2-methylsulfonylbenzamide |
|---|---|
| PubChem CID | 19064706 |
| Molecular Formula | C25H30N2O3S2 |
| Molecular Weight | 470.66 g/mol |
| Exact Mass | 470.17 |
| IUPAC Name | N-[3-(1-butylpiperidin-4-yl)-1-benzothiophen-5-yl]-2-methylsulfonylbenzamide |
| SMILES | CCCCN1CCC(c2csc3ccc(NC(=O)c4ccccc4S(C)(=O)=O)cc23)CC1 |
| InChI | InChI=1S/C25H30N2O3S2/c1-3-4-13-27-14-11-18(12-15-27)22-17-31-23-10-9-19(16-21(22)23)26-25(28)20-7-5-6-8-24(20)32(2,29)30/h5-10,16-18H,3-4,11-15H2,1-2H3,(H,26,28) |
| InChIKey | OFEZHXKYHVEIQU-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.66 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |